T9688830
Pinacyanol Iodide , >90.0%(HPLC) , 605-91-4
Synonym(s):
Pinacyanol iodide;Quinaldine blue
CAS NO.：605-91-4
Empirical Formula: C25H25IN2
Molecular Weight: 480.38
MDL number: MFCD00011975
EINECS: 210-099-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB460.00 | In Stock |
|
| 5g | RMB1364.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | ethanol: 10mg/mL |
| form | powder to crystal |
| color | Green to Dark green |
| λmax | 614 nm |
| ε(extinction coefficient) | ≥180000 at 602-608nm in ethanol ≥80000 at 560-566nm in ethanol |
| BRN | 4117070 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C25H25N2.HI/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QWYZFXLSWMXLDM-UHFFFAOYSA-M |
| SMILES | [I-].CCN1\C(=C\C=C\c2ccc3ccccc3[n+]2CC)C=Cc4ccccc14 |
| CAS DataBase Reference | 605-91-4(CAS DataBase Reference) |
Description and Uses
The fluorescence decay time of pinacyanol (1,1?-diethyl-2,2?-carbocyanine) iodide has been measured in the temperature range 95-225 K.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | VC3676870 |
| HS Code | 2933.49.7000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |
