T9688930
Pinakryptol Yellow , 25910-85-4
Synonym(s):
6-Ethoxy-1-methyl-2-(3-nitro-β-styryl)quinolinium methyl sulfate;DYRK6;FIST3;PKY;YAK1
CAS NO.：25910-85-4
Empirical Formula: C21H22N2O7S
Molecular Weight: 446.47
MDL number: MFCD00011967
EINECS: 247-336-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260-262 °C(lit.) |
| storage temp. | -70°C |
| form | buffered aqueous glycerol solution |
| color | Light yellow to Amber to Dark green |
| Specific Activity | 41-56nmol/min·mg |
| BRN | 3881592 |
| InChIKey | ZXQHSPWBYMLHLB-BXTVWIJMSA-M |
| SMILES | C12=CC=C(/C=C/C3C=CC=C([N+]([O-])=O)C=3)[N+](C)=C1C=CC(OCC)=C2.S([O-])(=O)(=O)OC |
| CAS DataBase Reference | 25910-85-4(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Ethoxy-1-methyl-2-(m-nitrostyryl)quinolinium methyl sulfate (25910-85-4) |
Description and Uses
HIPK3 (homeodomain-interacting protein kinase 3) is strongly expressed in the heart and muscle tissues. It is up-regulated in multidrug-resistant cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29334900 |
| Storage Class | 10 - Combustible liquids |
