PRODUCT Properties
| Melting point: | 95 °C |
| Boiling point: | 318.5±42.0 °C(Predicted) |
| Density | 1.68±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), Dichloromethane (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | agriculture environmental |
| InChI | 1S/C7H3Cl5S/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | LGZZJTIUEJNNKV-UHFFFAOYSA-N |
| SMILES | CSc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 1825-19-0(CAS DataBase Reference) |
Description and Uses
Pentachlorothioanisole is used in the preparation of arenethiols and arenethiolates as seen in agrochemicals or fungicides.
Safety
| Hazard statements | H413 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | WGK 3 |
| RTECS | WQ5520000 |
| HS Code | 2930.90.2900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 1825-19-0(Hazardous Substances Data) |
