T9858130
RuCl2[(R)-dm-segphos?][(R,R)-dpen] , 944450-45-7
CAS NO.:944450-45-7
Empirical Formula: C60H60Cl2N2O4P2Ru
Molecular Weight: 1107.07
MDL number: MFCD09753031
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB460.00 | In Stock |
|
| 1g | RMB1656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| form | Powder |
| color | yellow |
| Sensitive | air sensitive |
| InChIKey | FOEKPXQPRAIJRW-ODQAEMFESA-L |
| SMILES | Cl[Ru]Cl.N[C@@H]([C@H](N)c1ccccc1)c2ccccc2.Cc3cc(C)cc(c3)P(c4cc(C)cc(C)c4)c5ccc6OCOc6c5-c7c8OCOc8ccc7P(c9cc(C)cc(C)c9)c%10cc(C)cc(C)c%10 |
Description and Uses
RuCl2[(R)-(DM-SEGPHOS?)][(R,(R))-(DPEN)] can be used as a catalyst in the enantioselective preparation of chiral amino alcohols and their derivatives by asymmetric hydrogenation of various amino ketones using mild hydrogen pressure.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H373-H371-H360 |
| Precautionary statements | P260-P314-P501-P260-P264-P270-P309+P311-P405-P501 |
| WGK Germany | 3 |
| HS Code | 2843.90.0000 |
| Storage Class | 13 - Non Combustible Solids |

![RuCl2[(R)-dm-segphos?][(R,R)-dpen]](https://img.chemicalbook.com/CAS/20180808/GIF/944450-45-7.gif)

![RuCl2[(S)-dm-segphos?][(S)-daipen]](https://img.chemicalbook.com/CAS/GIF/944450-44-6.gif)
![RuCl2[(R)-dm-segphos?][(R)-daipen]](https://img.chemicalbook.com/CAS/20180906/GIF/944450-43-5.gif)
![RuCl2[(S)-dm-segphos?][(S,S)-dpen]](https://img.chemicalbook.com/CAS/20180906/GIF/944450-46-8.gif)
