T9862030
Ribostamycin Sulfate , >90.0%(N) , 53797-35-6
CAS NO.:53797-35-6
Empirical Formula: C17H22N4O10S
Molecular Weight: 474.442
MDL number: MFCD02264592
EINECS: 258-783-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-180 C |
| alpha | D20 +39° (c = 1) |
| Flash point: | >110°(230°F) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | White to Off-White |
| Water Solubility | Soluble in water |
| Merck | 14,8206 |
| Stability: | Hygroscopic |
| InChIKey | RTCDDYYZMGGHOE-CARKYZAMNA-N |
| SMILES | OS(O)(=O)=O.NC[C@@H]1O[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O)[C@@H]2O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](N)[C@H](O)[C@H]1O |
Description and Uses
Ribostamycin is a broad-spectrum antimicrobial isolated from Streptomyces ribosifidicus. It is used in pharmacokinetic and nephrotoxicity studies.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H312+H332-H360 |
| Precautionary statements | P201-P202-P280-P302+P352+P312-P304+P340+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 61-20/21/22-36/38 |
| Safety Statements | 53-22-36/37/39-45-37/39-26 |
| WGK Germany | 3 |
| RTECS | WK2300000 |
| HS Code | 2941.90.1010 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Repr. 1B |
| Toxicity | LD50 i.v. in mice: 225 mg/kg (Shomura) |





