PRODUCT Properties
| form | powder to crystal |
| color | White to Gray to Brown |
| InChI | 1S/C12H6Cl4O2S.2Na/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18;;/h1-4,17-18H;;/q;2*+1/p-2 |
| InChIKey | FNYZFZRGBBCWBI-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]c1c(Cl)cc(Cl)cc1Sc2cc(Cl)cc(Cl)c2[O-] |
| EPA Substance Registry System | Bithionolate sodium (6385-58-6) |
Description and Uses
Anti-infective, topical.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 61 |
| WGK Germany | WGK 3 |
| RTECS | SN0700000 |
| HS Code | 2930.90.2900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
