T9964030
1,1,2,3-Tetrachloropropane , >97.0%(GC) , 18495-30-2
CAS NO.:18495-30-2
Empirical Formula: C3H4Cl4
Molecular Weight: 181.88
MDL number: MFCD00039343
EINECS: 242-379-7
| Pack Size | Price | Stock | Quantity |
| 10mL | RMB1480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179°C |
| Boiling point: | 179 °C |
| Density | 1,53 g/cm3 |
| refractive index | 1.4990-1.5010 |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C3H4Cl4/c4-1-2(5)3(6)7/h2-3H,1H2 |
| InChIKey | BUQMVYQMVLAYRU-UHFFFAOYSA-N |
| SMILES | C(Cl)(Cl)C(Cl)CCl |
| EPA Substance Registry System | Propane, 1,1,2,3-tetrachloro- (18495-30-2) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302-H315-H319 |
| Precautionary statements | P210-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2903.19.6050 |





![Diallyl 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate](https://img.chemicalbook.com/CAS/GIF/3232-62-0.gif)
