T9990830
1,1,3,3-Tetramethylbutyl Isocyanide , >95.0%(GC) , 14542-93-9
Synonym(s):
tert-Octyl isocyanide;1,1,3,3-Tetramethylbutyl isocyanide;Thiocarbamide, 1,1,3,3,-Tetramethylbutylisonitrile, Walborsky reagent, tert-Octylisonitrile;Walborsky’s reagent
CAS NO.:14542-93-9
Empirical Formula: C9H17N
Molecular Weight: 139.24
MDL number: MFCD00000003
EINECS: 238-577-8
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB308.00 | In Stock |
|
| 5mL | RMB900.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 55-57 °C11 mm Hg(lit.) |
| Density | 0.794 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | 2-8°C |
| solubility | insol water; sol common organic solvents |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2076559 |
| InChI | InChI=1S/C9H17N/c1-8(2,3)7-9(4,5)10-6/h7H2,1-5H3 |
| InChIKey | YVPXQMYCTGCWBE-UHFFFAOYSA-N |
| SMILES | C(C(C)(C)C)C(C)(C)[N+]#[C-] |
| CAS DataBase Reference | 14542-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | Pentane, 2-isocyano-2,4,4-trimethyl- (14542-93-9) |
Description and Uses
1,1,3,3-Tetramethylbutyl isocyanide was used in the synthesis of substituted furans and imides.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P370+P378 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 10-20/21/22 |
| Safety Statements | 23-36/37 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2929 90 00 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |



