Abietic acid , 75% , 514-10-3
CAS NO.:514-10-3
Empirical Formula: C20H30O2
Molecular Weight: 302.45
MDL number: MFCD03423567
EINECS: 208-178-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB49.60 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB462.40 | In Stock |
|
| 500g | RMB1735.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 139-142 °C (lit.)
150-165 °C |
| alpha | D24 -106° (c = 1 in abs alc) |
| Boiling point: | 440℃ |
| Density | 1.06 |
| refractive index | 1.4800 (estimate) |
| Flash point: | 208℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in alcohols, acetone and ethers |
| pka | pK1:7.62 (25°C) |
| form | Crystals and Chunks |
| color | Yellow-brownish |
| Odor | at 100.00%. mild acetic |
| optical activity | [α]20/D 85±10°, c = 1% in ethanol |
| Water Solubility | Soluble in acetone, petroleum ether, diethyl ether and ethanol. Insoluble in water. |
| Sensitive | Air Sensitive |
| Merck | 14,7 |
| BRN | 2221451 |
| Exposure limits | NIOSH: TWA 0.1 mg/m3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING |
| InChI | 1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22)/t16-,17+,19+,20+/m0/s1 |
| InChIKey | RSWGJHLUYNHPMX-ONCXSQPRSA-N |
| SMILES | CC(C)C1=CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(O)=O)[C@H]2CC1 |
| LogP | 6.460 |
| CAS DataBase Reference | 514-10-3(CAS DataBase Reference) |
| EPA Substance Registry System | Abietic acid (514-10-3) |
Description and Uses
Abietic acid is probably a major allergen of colophony, by way of oxidation products. Its detection in a material indicates that allergenic components of colophony are present.
manufacture of esters (ester gums), e.g., methyl ester, vinyl and glyceryl esters for use in lacquers and varnishes; manufacture of "metal resinates", soaps, plastics, and paper sizes; assists growth of lactic and butyric acid bacteria; component in tall oil used as deodorizing agent in cooling fluids; major component of rosin used in the production of varnishes, printing inks, paper, soldering fluxes, greases, cutting fluids, glue tackifiers, adhesives, surface coatings, polish, shoes, insulations, waxes, cosmetics (mascara, rouge, eye shadow), topical medicaments, violin bow rosin, day, athletic grip aid, pine oil deansers; component in dental impression materials and periodontal packings
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50-50/53 |
| Safety Statements | 26-36 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TP8580000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ivn-mus: 180 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






