A0936150
(S)-(-)-1-Methyl-2-pyrrolidinemethanol , 97% , 34381-71-0
Synonym(s):
(S)-2-Hydroxymethyl-1-methylpyrrolidine;N-Methyl-L -prolinol
CAS NO.：34381-71-0
Empirical Formula: C6H13NO
Molecular Weight: 115.17
MDL number: MFCD00011727
EINECS: 251-981-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB46.40 | In Stock |
|
| 25g | RMB170.40 | In Stock |
|
| 100g | RMB604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -49.5 º (c=5, MeOH) |
| Boiling point: | 67-69 °C12 mm Hg(lit.) |
| Density | 0.968 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 146 °F |
| storage temp. | 2-8°C |
| pka | 14.77±0.10(Predicted) |
| form | Liquid |
| color | Colorless to yellow |
| optical activity | [α]19/D 49.5°, c = 5 in methanol |
| BRN | 79851 |
| InChI | InChI=1S/C6H13NO/c1-7-4-2-3-6(7)5-8/h6,8H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | VCOJPHPOVDIRJK-LURJTMIESA-N |
| SMILES | N1(C)CCC[C@H]1CO |
| CAS DataBase Reference | 34381-71-0(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Methyl-L-prolinol(34381-71-0) |
Description and Uses
Precursor to phosphine ligands for catalytic asymmetric Grignard cross-coupling reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36-26 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
