A1021012
2-Amino-3-fluorobenzonitrile , 98% , 115661-37-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 252.4±25.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.42±0.10(Predicted) |
| form | Solid |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C7H5FN2/c8-6-3-1-2-5(4-9)7(6)10/h1-3H,10H2 |
| InChIKey | UNISSOLHERSZOW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(F)=C1N |
Description and Uses
2-Amino-3-fluorobenzonitrile is used as an intermediate in organic synthesis and medicinal chemistry, and is mostly used in basic chemical research and modification of pharmaceutical molecules.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | TOXIC |
| HazardClass | 6.1 |
| HS Code | 2926907090 |






