A1079912
2-Amino-6-bromonaphthalene , 98% , 7499-66-3
CAS NO.：7499-66-3
Empirical Formula: C10H8BrN
Molecular Weight: 222.08
MDL number: MFCD01026466
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1G | RMB69.84 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128 °C |
| Boiling point: | 155-160 °C(Press: 1 Torr) |
| Density | 1.563±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 3.66±0.10(Predicted) |
| color | grey |
| InChI | InChI=1S/C10H8BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H,12H2 |
| InChIKey | UBLKHAWYJFEPDX-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1N |
Description and Uses
6-Bromonaphthalen-2-amine is used in the new synthesis of alkylsulphanylnaphthalenes and the synthesis and mesomorphic properties of novel naphthylisothiocyanates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Note | Irritant |
| HS Code | 2921450090 |