A1329512
6-Bromo-2,2′-bipyridine , 97% , 10495-73-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB143.20 | In Stock |
|
| 1G | RMB479.20 | In Stock |
|
| 5G | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72.0 to 76.0 °C |
| Boiling point: | 133°C/2.2mmHg(lit.) |
| Density | 1.493±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform, Methanol |
| form | powder to crystal |
| pka | 3.70±0.22(Predicted) |
| color | White to Almost white |
| BRN | 130238 |
| InChI | InChI=1S/C10H7BrN2/c11-10-6-3-5-9(13-10)8-4-1-2-7-12-8/h1-7H |
| InChIKey | NCRIDSGPLISUEU-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC=C2)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 10495-73-5 |
Description and Uses
6-Bromo-2,2’-bipyridine is a reagent used in the synthesis of electron transporting layers for OLEDs.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
