A1329912
Bis(4-biphenylyl)amine , 98% , 102113-98-4
CAS NO.:102113-98-4
Empirical Formula: C24H19N
Molecular Weight: 321.41
MDL number: MFCD08276279
EINECS: 678-161-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 10G | RMB124.80 | In Stock |
|
| 25G | RMB324.00 | In Stock |
|
| 100G | RMB1019.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209 °C |
| Boiling point: | 507.0±39.0 °C(Predicted) |
| Density | 1.123±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) |
| pka | 0.67±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C24H19N/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18,25H |
| InChIKey | JAUCIDPGGHZXRP-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(NC2=CC=C(C3=CC=CC=C3)C=C2)C=C1 |
Description and Uses
Bis(4-biphenylyl)amine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2921490090 |





![N,N'-Diphenyl-N,N'-bis[4'-(diphenylamino)biphenyl-4-yl]benzidine](https://img.chemicalbook.com/CAS/GIF/167218-46-4.gif)