A2506412
5-Chloro-2-nitrodiphenylamine , ≥98.0%(GC) , 25781-92-4
CAS NO.：25781-92-4
Empirical Formula: C12H9ClN2O2
Molecular Weight: 248.67
MDL number: MFCD00007287
EINECS: 247-261-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB116.00 | In Stock |
|
| 25G | RMB396.00 | In Stock |
|
| 100G | RMB1231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-114 °C |
| Boiling point: | 370.4±32.0 °C(Predicted) |
| Density | 1.3696 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | -4.38±0.50(Predicted) |
| color | Orange to Red |
| InChI | InChI=1S/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
| InChIKey | FPKHZBVGKMTUHB-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC(Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 25781-92-4(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-nitrodiphenylaMine can be used in the preparation of substituted Phenylbenzimidazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| HS Code | 29214400 |
