A3198812
Diphenylphosphine oxide , 98% , 4559-70-0
Synonym(s):
HPOPh2
CAS NO.：4559-70-0
Empirical Formula: C12H11OP
Molecular Weight: 202.19
MDL number: MFCD00002079
EINECS: 625-671-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB187.20 | In Stock |
|
| 100G | RMB545.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-57 °C(lit.) |
| Boiling point: | 102-105°C 0,2mm |
| refractive index | 1.608-1.61 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals |
| color | Yellow to light orange |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C12H11OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | ASUOLLHGALPRFK-UHFFFAOYSA-N |
| SMILES | P(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 4559-70-0(CAS DataBase Reference) |
Description and Uses
Used in the preparation of triarylphosphine oxides, and as asymmetric catalysts, preparation of alkenyldiphenylphosphine oxides, and Horner-Wittig reagents. It is a ligand for Buchwald-Hartwig Cross Coupling Reaction, Hydrophosphonylations and Suzuki-Miyaura Coupling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| HS Code | 29319090 |
