A3276512
2',6'-Difluoroacetophenone , 98% , 13670-99-0
CAS NO.：13670-99-0
Empirical Formula: C8H6F2O
Molecular Weight: 156.13
MDL number: MFCD00000328
EINECS: 237-151-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB295.20 | In Stock |
|
| 100g | RMB1136.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-55°C |
| Boiling point: | 76-79 °C15 mm Hg(lit.) |
| Density | 1.197 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 170 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| Specific Gravity | 1.197 |
| color | Clear colorless to slightly yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 2046068 |
| InChI | InChI=1S/C8H6F2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| InChIKey | VGIIILXIQLXVLC-UHFFFAOYSA-N |
| SMILES | C1C(F)=C(C(=O)C)C(F)=CC=1 |
| CAS DataBase Reference | 13670-99-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(2,6-difluorophenyl)-(13670-99-0) |
Description and Uses
2?,6?-Difluoroacetophenone was used in the synthesis of 2-amino-4-alkyl- and 2-amino-4-arylquinazolines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
