A3301512
3,5-Di-tert-butylbenzoic acid , 98% , 16225-26-6
CAS NO.：16225-26-6
Empirical Formula: C15H22O2
Molecular Weight: 234.33
MDL number: MFCD00082727
EINECS: 240-350-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.40 | In Stock |
|
| 5G | RMB311.20 | In Stock |
|
| 25G | RMB1247.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-175 °C(lit.) |
| Boiling point: | 361.43°C (estimate) |
| Density | 0.9725 (estimate) |
| refractive index | 1.5283 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder or Crystalline Powder |
| pka | 4.40±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| BRN | 981248 |
| InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6/h7-9H,1-6H3,(H,16,17) |
| InChIKey | NCTSLPBQVXUAHR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| CAS DataBase Reference | 16225-26-6(CAS DataBase Reference) |
Description and Uses
3,5-Di-tert-butylbenzoic acid is used in the synthesis of 5,5-di-tert-butylanilinium sulfate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HS Code | 29163990 |
