A4780912
Hydrindantin dihydrate , >98.0% , 5950-69-6
CAS NO.：5950-69-6
Empirical Formula: C18H14O8
Molecular Weight: 358.3
MDL number: MFCD00003781
EINECS: 227-713-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB127.20 | In Stock |
|
| 5G | RMB439.20 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252 °C (dec.)(lit.) |
| Boiling point: | 410.75°C (rough estimate) |
| Density | 1.3594 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 10.12±0.40(Predicted) |
| color | Light beige to beige-pink |
| Water Solubility | Insoluble in water. Soluble with decomposition in aqueous sodium carbonate (deep red color) and in sodium hydroxide solutions (deep blue color). |
| Merck | 14,4775 |
| BRN | 1895666 |
| InChI | InChI=1S/C18H14O8/c19-13-9-5-1-3-7-11(9)17(23,24)15(13,21)16(22)14(20)10-6-2-4-8-12(10)18(16,25)26/h1-8,21-26H |
| InChIKey | QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(O)(O)C1(O)C1(O)C(O)(O)C2=C(C1=O)C=CC=C2 |
| CAS DataBase Reference | 5950-69-6(CAS DataBase Reference) |
| EPA Substance Registry System | [2,2'-Bi-1H-indene]-1,1'-dione, 2,2',3,3'-tetrahydro-2,2',3,3,3',3'-hexahydroxy- (5950-69-6) |
Description and Uses
Hydrindantin hydrate is a biochemical assay reagent, which is utilized in quantitation determination of amino acid[1].
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41-36/37/38 |
| Safety Statements | 26-39-36/37/39-27 |
| WGK Germany | 2 |
| RTECS | DU2989000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29144090 |
