A5136912
<I>N</I>-Cyclohexylaniline , 98.0%(GC) , 1821-36-9
CAS NO.：1821-36-9
Empirical Formula: C12H17N
Molecular Weight: 175.27
MDL number: MFCD00014284
EINECS: 217-344-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB202.40 | In Stock |
|
| 10G | RMB338.40 | In Stock |
|
| 25g | RMB680.80 | In Stock |
|
| 100g | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14-15°C |
| Boiling point: | 191-192 °C (73 mmHg) |
| Density | 0.996 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 136 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 5.46±0.20(Predicted) |
| form | liquid |
| color | Orange |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2209864 |
| InChI | InChI=1S/C12H17N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2 |
| InChIKey | TXTHKGMZDDTZFD-UHFFFAOYSA-N |
| SMILES | C1(NC2CCCCC2)=CC=CC=C1 |
| CAS DataBase Reference | 1821-36-9(CAS DataBase Reference) |
| EPA Substance Registry System | N-Cyclohexylaniline (1821-36-9) |
Description and Uses
N-Cyclohexylaniline has been used as reagent in palladium-catalyzed amination of aromatic bromides. It is also used to produce N-cyclohexyl-N-phenyl-urea at ambient temperature.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 23-36/37 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29214900 |
