A6307812
4-Nitroanthranilic Acid , >97.0%(HPLC)(T) , 619-17-0
CAS NO.:619-17-0
Empirical Formula: C7H6N2O4
Molecular Weight: 182.13
MDL number: MFCD00007262
EINECS: 210-583-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB279.20 | In Stock |
|
| 500G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 257 °C (dec.)(lit.) |
| Boiling point: | 315.51°C (rough estimate) |
| Density | 1.5181 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.92±0.13(Predicted) |
| form | Crystalline Powder |
| color | Orange |
| Water Solubility | <0.01 g/100 mL at 22 ºC |
| InChI | InChI=1S/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | UEALKTCRMBVTFN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1N |
| CAS DataBase Reference | 619-17-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Nitroanthranilic acid (619-17-0) |
Description and Uses
2-Amino-4-nitrobenzoic acid (also known as 4-Nitroanthranilic acid) is primarily used as an intermediate in the synthesis of dyes and pharmaceuticals. It is also used in crystal or eutectic molecular structure research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CB3675000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Hazardous Substances Data | 619-17-0(Hazardous Substances Data) |




