A7389012
scyllo-Inositol , ≥99.0%(HPLC) , 488-59-5
Synonym(s):
1,3,5/2,4,6-Hexahydroxycyclohexane;DTLET
CAS NO.：488-59-5
Empirical Formula: C6H12O6
Molecular Weight: 180.16
MDL number: MFCD00065455
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB159.20 | In Stock |
|
| 50mg | RMB479.20 | In Stock |
|
| 250MG | RMB1599.20 | In Stock |
|
| 1G | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 350 °C |
| Boiling point: | 291.3±40.0 °C(Predicted) |
| Density | 2.038±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 0 ° (C=1, H2O) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 12.63±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 10.1g/L(18 ºC) |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3+,4+,5-,6- |
| InChIKey | CDAISMWEOUEBRE-CDRYSYESSA-N |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O |
| CAS DataBase Reference | 488-59-5(CAS DataBase Reference) |
| EPA Substance Registry System | scyllo-Inositol (488-59-5) |
Description and Uses
scyllo-Inositol, acyclohexanehexol derivative used in the treatment of amyotrophic lateral sclerosis. Anti-Alzheimer''s agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29061990 |
