A7738912
2,3,5,6-Tetrafluorophenol , 97% , 769-39-1
CAS NO.：769-39-1
Empirical Formula: C6H2F4O
Molecular Weight: 166.07
MDL number: MFCD00002157
EINECS: 212-209-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100G | RMB1223.20 | In Stock |
|
| 500g | RMB4856.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C (lit.) |
| Boiling point: | 140 °C (lit.) |
| Density | 1.4445 (estimate) |
| Flash point: | 175 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.46±0.20(Predicted) |
| form | Crystalline Low Melting Solid |
| color | White |
| Water Solubility | Partly miscible with water. |
| BRN | 1911548 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents. |
| InChI | InChI=1S/C6H2F4O/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H |
| InChIKey | PBYIIRLNRCVTMQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C(F)=CC(F)=C1F |
| CAS DataBase Reference | 769-39-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5,6-Tetrafluorophenol(769-39-1) |
Description and Uses
2,3,5,6-Tetrafluorophenol is a reagent in the preparation of polyfluorophenyl ester-terminated homobifunctional cross-linkers to be used in protein conjugation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29081990 |
