A7801412
3-(2-Thienyl)-2-propenoic acid , 98% , 1124-65-8
Synonym(s):
2-Thiopheneacrylic acid
CAS NO.：1124-65-8
Empirical Formula: C7H6O2S
Molecular Weight: 154.19
MDL number: MFCD00005455
EINECS: 214-402-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB158.40 | In Stock |
|
| 25G | RMB615.20 | In Stock |
|
| 100g | RMB1542.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C(lit.) |
| Boiling point: | 298.9±15.0 °C(Predicted) |
| Density | 1.346±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 4.34±0.10(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9) |
| InChIKey | KKMZQOIASVGJQE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1SC=CC=1 |
| CAS DataBase Reference | 1124-65-8(CAS DataBase Reference) |
Description and Uses
3-(2-Thienyl)acrylic Acid is used as a phenylalanine derivative which shows improved intestinal absorption of insulin in mice. In addition it has been used in the synthesis of novel benzothiazepinones as glycogen synthase kinase-3β inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
