A7936512
4-(Trifluoromethyl)phenyl Isothiocyanate , >98.0%(GC) , 1645-65-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-43 °C(lit.) |
| Boiling point: | 81 °C11 mm Hg(lit.) |
| Density | 1.3395 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| form | powder to lump |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2693553 |
| InChI | InChI=1S/C8H4F3NS/c9-8(10,11)6-1-3-7(4-2-6)12-5-13/h1-4H |
| InChIKey | DQEVDFQAYLIBRD-UHFFFAOYSA-N |
| SMILES | C1(N=C=S)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 1645-65-4(CAS DataBase Reference) |
| NIST Chemistry Reference | P-trifluoromethylphenylisothiocyanate(1645-65-4) |
Description and Uses
4-(Trifluoromethyl)phenyl isothiocyanate may be used in the synthesis of 6-[1-amino-3-(4-trifluoromethylphenyl)-thiourea]-2-ethylbenzo[de]isoquinoline-1,3-dione. It may also be used in the synthesis of photoinduced electron transfer (PET) sensors.
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H334 |
| Precautionary statements | P260-P280-P284-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi,T,Xn |
| Risk Statements | 34-42-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45-22 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
