BD0871648
Methylbenzimidatehydrochloride , 98% , 5873-90-5
Synonym(s):
Benzimidoic acid methyl ester hydrochloride;Methyl benzenecarboximidate hydrochloride
CAS NO.：5873-90-5
Empirical Formula: C8H10ClNO
Molecular Weight: 171.62
MDL number: MFCD00012575
EINECS: 227-537-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB320.80 | In Stock |
|
| 5g | RMB1044.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107 °C (dec.)(lit.) |
| Boiling point: | 106 °C(Press: 24 Torr) |
| storage temp. | -20°C |
| form | Crystalline Powder |
| color | White |
| Water Solubility | almost transparency |
| InChI | InChI=1S/C8H9NO.ClH/c1-10-8(9)7-5-3-2-4-6-7;/h2-6,9H,1H3;1H |
| InChIKey | HDJNHVNQRJMWSH-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)C(=N)OC.Cl |
Description and Uses
Methyl benzimidate hydrochloride was used:
- in the synthesis of chiral phenyldihydroimidazole derivative
- as imidating reagent to modify Lys residues of cyclic Lys-Gly-Asp peptide to afford acetimidate analogs
- in the synthesis of N-benzimidoyl-(1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29299000 |
