BD1109032
2,4-Dibromo-1,1'-biphenyl , 98% , 53592-10-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB74.40 | In Stock |
|
| 5g | RMB240.80 | In Stock |
|
| 25g | RMB868.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 235 °C(Press: 15 Torr) |
| Density | 1.667±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Semi-Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C12H8Br2/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | BWVLLEHUUJBZMR-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(Br)C=C1Br |
| EPA Substance Registry System | PBB 007 (53592-10-2) |
Description and Uses
2,4-Dibromobiphenyl can be used as a flame retardant and often incorporated into consumer products including appliances, electronics and plastics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |






