Dbco-amine , 98% , 1255942-06-3
Synonym(s):
DBCO-amine;DBCO-NH2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB1665.60 | In Stock |
|
| 100mg | RMB2479.20 | In Stock |
|
| 250mg | RMB4548.80 | In Stock |
|
| 1g | RMB11370.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 86-96°C |
| Boiling point: | 549.9±50.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 8.81±0.10(Predicted) |
| form | Solid |
| color | Yellow to Orange |
| InChI | InChI=1S/C18H16N2O/c19-12-11-18(21)20-13-16-7-2-1-5-14(16)9-10-15-6-3-4-8-17(15)20/h1-8H,11-13,19H2 |
| InChIKey | PQFQVUMDOWUGMK-CHMOPDDRSA-N |
| SMILES | C(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)(=O)CCN |
Description and Uses
DBCO-amine is a simple building block containing a DBCO moiety and will add minimal spacer to the modified molecules. In the presence of activators such as EDC or HATU, this reagent can be used to derivatize carboxyl groups or activated esters (e.g. The NHS ester) through a stable amide bond. DBCO is commonly used for copper-free Click Chemistry reactions.
Azadibenzocyclooctyne amine is a carbonyl reactive reagent used to incorporate ADIBO into organic compounds, surfaces or particlesAzadibenzocyclooctyne amine is widely useful in strain-promoted copper-free azide-alkyne cycloaddition reactions. It reacts with azide functionalized compounds or bimolecules to give stable triazole linkage without a need for a Cu(I) catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | 3 |
| HS Code | 29339900 |
