BD8018331
Mesosulfuron-methyl , 98% , 208465-21-8
CAS NO.:208465-21-8
Empirical Formula: C17H21N5O9S2
Molecular Weight: 503.51
MDL number: MFCD04112616
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB120.80 | In Stock |
|
| 1g | RMB300.80 | In Stock |
|
| 5g | RMB912.80 | In Stock |
|
| 10g | RMB1463.20 | In Stock |
|
| 25g | RMB2930.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195.4° |
| Density | 1.498±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Solubility in organic solvents (g/l at 20 °C) Acetone 13.66 Ethyl acetate 2.0 Dichloromethane 3.8 n‐Hexane <0.0002 Toluene 0.013. |
| form | Powder |
| pka | Dissociation constant (pKa at 20 °C):4.35. |
| color | White to off-white |
| Water Solubility | Solubility in water (g/l at 20 °C) 0.007 (pH 5) 0.483 (pH 7) 15.39 (pH 9). |
| InChI | InChI=1S/C17H21N5O9S2/c1-29-13-8-14(30-2)20-16(19-13)21-17(24)22-33(27,28)12-7-10(9-18-32(4,25)26)5-6-11(12)15(23)31-3/h5-8,18H,9H2,1-4H3,(H2,19,20,21,22,24) |
| InChIKey | NIFKBBMCXCMCAO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(CNS(C)(=O)=O)C=C1S(NC(NC1=NC(OC)=CC(OC)=N1)=O)(=O)=O |
| EPA Substance Registry System | Mesosulfuron-methyl (208465-21-8) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| Hazardous Substances Data | 208465-21-8(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >5000 dermally; LC50 in rats: >1.33 mg/l air (Hacker) |





