BD8787031
6-Bromo-2-nitropyridin-3-ol , 97% , 443956-08-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB103.20 | In Stock |
|
| 5g | RMB383.20 | In Stock |
|
| 10g | RMB673.60 | In Stock |
|
| 25g | RMB1332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 413.0±40.0 °C(Predicted) |
| Density | 2.006±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -1.31±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C5H3BrN2O3/c6-4-2-1-3(9)5(7-4)8(10)11/h1-2,9H |
| InChIKey | GSGNTVQLHGOEMB-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC(Br)=CC=C1O |
Description and Uses
6-?Bromo-?2-?nitropyridin-?3-?ol acts as a reagent for the synthesis of oxabicyclooctane-linked novel bacterial topoisomerase inhibitors as broad spectrum antibacterial agents. Also, functions as a reagent for the preparation of α-styrylpyridines via palladium-catalyzed coupling of N-tosylhydrazones with halopyridines, and their antitumor activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H315-H302-H319-H312-H335 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2933399990 |
