BD9090147
6-Azuridine , 98% , 54-25-1
Synonym(s):
2-β-D -Ribofuranosyl-1,2,4-triazine-3,5(2H,4H)-dione;6-Azauracil riboside
CAS NO.：54-25-1
Empirical Formula: C8H11N3O6
Molecular Weight: 245.19
MDL number: MFCD00006472
EINECS: 200-199-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB100.00 | In Stock |
|
| 250mg | RMB163.20 | In Stock |
|
| 1g | RMB301.60 | In Stock |
|
| 5g | RMB1453.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-159 °C(lit.) |
| Boiling point: | 388.15°C (rough estimate) |
| Density | 1.4866 (rough estimate) |
| refractive index | 1.7950 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated), Pyridine (Slightly), Water |
| form | Powder |
| pka | 6.70(at 25℃) |
| color | White |
| Water Solubility | It is soluble in water. |
| Merck | 14,904 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C8H11N3O6/c12-2-3-5(14)6(15)7(17-3)11-8(16)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,16)/t3-,5-,6-,7-/s3 |
| InChIKey | WYXSYVWAUAUWLD-YGWZKZRUSA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](CO)O[C@H]1N1N=CC(=O)NC1=O)O |&1:1,2,3,7,r| |
| CAS DataBase Reference | 54-25-1(CAS DataBase Reference) |
Description and Uses
6-Azauridine (AzUrd) blocks the conversion of orotic acid into UMP and it is used in antiviral studies.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H351 |
| Precautionary statements | P201-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| RTECS | XY8575000 |
| HS Code | 29349990 |
| Hazardous Substances Data | 54-25-1(Hazardous Substances Data) |
| Toxicity | LD50 oral in quail: > 316mg/kg |
