PRODUCT Properties
Boiling point: | 161-162 °C(lit.) |
Density | 0.770 g/mL at 25 °C(lit.) |
refractive index | n |
Flash point: | 171 °F |
storage temp. | 2-8°C |
form | Liquid |
pka | 5.40±0.50(Predicted) |
InChI | InChI=1S/C16H19N/c1-3-17(13-15-9-5-4-6-10-15)16-11-7-8-14(2)12-16/h4-12H,3,13H2,1-2H3 |
InChIKey | VIACAIAQHPLINF-UHFFFAOYSA-N |
SMILES | C1(CN(CC)C2=CC=CC(C)=C2)=CC=CC=C1 |
CAS DataBase Reference | 119-94-8(CAS DataBase Reference) |
NIST Chemistry Reference | Benzenemethanamine, n-ethyl-n-(3-methylphenyl)-(119-94-8) |
EPA Substance Registry System | N-Benzyl-N-ethyl-m-toluidine (119-94-8) |
Description and Uses
Ethylbenzyltoluidine is a yellowish to lightbrown liquid with an unpleasant odor. Boilingpoint = 230℃; Flash point = 167℃. Insoluble in water.
Ethylbenzyltoluidine can be used as an intermediate for acid blue 90, 91, 109 and other dyes.
Safety
Symbol(GHS) | ![]() GHS06 |
Signal word | Warning |
Hazard statements | H227-H301-H311-H331 |
Precautionary statements | P210e-P261-P280-P301+P310a-P405-P501a |
Hazard Codes | T |
Risk Statements | 23/24/25 |
Safety Statements | 23-26-36/37/39-45 |
RIDADR | UN 2753 6.1/PG 3 |
WGK Germany | 2 |
TSCA | Yes |
HazardClass | 6.1 |