![2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone](https://img.chemicalbook.com/CAS/GIF/71526-07-3.gif)
BD9182431
2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone , 95% , 71526-07-3
CAS NO.：71526-07-3
Empirical Formula: C10H15Cl2NO2
Molecular Weight: 252.14
MDL number: MFCD00184232
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB59.20 | In Stock |
|
| 1g | RMB160.80 | In Stock |
|
| 5g | RMB519.20 | In Stock |
|
| 10g | RMB852.00 | In Stock |
|
| 25g | RMB1728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 371.5±42.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -1.38±0.20(Predicted) |
| form | crystalline powder |
| color | White |
| InChI | InChI=1S/C10H15Cl2NO2/c11-8(12)9(14)13-6-7-15-10(13)4-2-1-3-5-10/h8H,1-7H2 |
| InChIKey | QWWHRELOCZEQNZ-UHFFFAOYSA-N |
| SMILES | C(=O)(N1C2(CCCCC2)OCC1)C(Cl)Cl |
| CAS DataBase Reference | 71526-07-3(CAS DataBase Reference) |
| EPA Substance Registry System | 4-(Dichloroacetyl)-1-oxa-4-azaspiro(4.5)decane (71526-07-3) |
Description and Uses
AD-67 (MON-4660) is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335-H351-H361 |
| Precautionary statements | P280-P305+P351+P338-P310 |
