LN-202328
sulfatroxazole , 0.95&0.99 , 23256-23-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 193-195.5 °C |
| Boiling point: | 484.9±55.0 °C(Predicted) |
| Density | 1.411±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.93±0.50(Predicted) |
| color | Pale Yellow to Pale Brown |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)17-13-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | DAUFGBIKKGOPJA-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C(C)=C(C)ON=2)(=O)=O)=CC=C(N)C=C1 |
Description and Uses
Sulfatroxazole is a component present in various veterinary drugs. Possible antibacterial activity due to presence of sulfonamide moiety in the structure.




