LN0578954
97% , 30044-51-0
Synonym(s):
3-(tert-Butyldithio)-L -alanine;S-(tert-Butylthio)-L -cysteine
CAS NO.：30044-51-0
Empirical Formula: C7H15NO2S2
Molecular Weight: 209.33
MDL number: MFCD00002609
EINECS: 250-012-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB340.00 | In Stock |
|
| 5g | RMB1313.60 | In Stock |
|
| 25g | RMB4348.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177 °C (dec.)(lit.) |
| Boiling point: | 324.7±37.0 °C(Predicted) |
| Density | 1.225 |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 2.03±0.10(Predicted) |
| color | White to off-white |
| BRN | 2247500 |
| InChI | InChI=1S/C7H15NO2S2/c1-7(2,3)12-11-4-5(8)6(9)10/h5H,4,8H2,1-3H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | TWMBHZTWEDJDRC-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CSSC(C)(C)C)N |
| CAS DataBase Reference | 30044-51-0(CAS DataBase Reference) |
Description and Uses
S-tert-butylmercapto-L-cysteine may be used to introduce synthetically useful S-tert-butylthio groups into peptides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P304+P340 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 13 |
| HS Code | 2930901600 |
