M1286135
1,1-Dibromoformaldoxime , 95% , 74213-24-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB46.40 | In Stock |
|
| 5g | RMB156.00 | In Stock |
|
| 25g | RMB572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-68 °C |
| Boiling point: | 230.0±23.0 °C(Predicted) |
| Density | 2.70±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Very Slightly, Heated), Methanol |
| form | Solid |
| pka | 7.52±0.11(Predicted) |
| color | White to Dark Orange |
| InChI | InChI=1S/CHBr2NO/c2-1(3)4-5/h5H |
| InChIKey | AWBKQZSYNWLCMW-UHFFFAOYSA-N |
| SMILES | C(/Br)(\Br)=N/O |
Description and Uses
Dibromoformaldoxime is a reagent that undergoes cycloaddition with alkynes to prepare substituted 3-bromo-isoxazoles in high yield.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P310-P261-P280 |
| HS Code | 2928009090 |
