PRODUCT Properties
| Melting point: | 227-228 °C |
| Boiling point: | 528.4±50.0 °C(Predicted) |
| Density | 1.548±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder |
| pka | 6.66±0.40(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H |
| InChIKey | ZFKKRRMUPBBYRS-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=C(O)C(O)=CC(O)=C2C(=O)C=1 |
| LogP | 1.970 (est) |
Description and Uses
Norwogonin, isolated from Scutellaria baicalensis Georgi, possesses antiviral activity against Enterovirus 71 (EV71) with an IC50 of 31.83 μg/ml[1]
