S6096049
Benzyl-2,3,4,5,6-d5chloride , 98atom%D , 68661-11-0
Synonym(s):
α-Chlorotoluene-2,3,4,5,6-d5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB10913.09 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −43 °C (lit.) |
| Boiling point: | 177-181 °C (lit.) |
| Density | 1.144 g/mL at 25 °C |
| refractive index | n 20/D 1.538 (lit.) |
| Flash point: | 60.00 °C - closed cup |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Clear Colourless |
| InChI | 1S/C7H7Cl/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D |
| InChIKey | KCXMKQUNVWSEMD-RALIUCGRSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(CCl)c([2H])c1[2H] |
Description and Uses
A labelled isotope of Benzyl Chloride.
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H302-H315-H317-H318-H331-H335-H350-H373 |
| Precautionary statements | P210-P280-P301+P312-P304+P340+P311-P305+P351+P338-P308+P313 |
| target organs | Heart,forestomach, Respiratory system |
| Hazard Codes | T |
| Risk Statements | 45-46-23/24/25-34 |
| Safety Statements | 53-23-26-36/37/39-45 |
| RIDADR | UN 1738 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 1B Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 Oral STOT SE 3 |
