S7556358
98atom%D , 39091-63-9
Synonym(s):
Isopropyl-d7 bromide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB590.30 | In Stock |
|
| 5G | RMB2258.18 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -89 °C (lit.) |
| Boiling point: | 59 °C (lit.) |
| Density | 1.383 g/mL at 25 °C |
| refractive index | n 20/D 1.421 (lit.) |
| Flash point: | 19 °C - closed cup |
| solubility | Chloroform (Slightly) |
| form | liquid |
| color | Colourless |
| InChI | InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3/i1D3,2D3,3D |
| InChIKey | NAMYKGVDVNBCFQ-YYWVXINBSA-N |
| SMILES | C([2H])(Br)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 75-26-3 |
Description and Uses
(2-Bromopropane-d7) Labelled analogue of 2-Bromopropane, a short chain alkyl halide used in organic synthesis primarily as an alkylating agent for introducing the isopropyl functional groups.
Safety
| Symbol(GHS) |   GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H360-H373 |
| Precautionary statements | P202-P210-P233-P240-P241-P308+P313 |
| Hazard Codes | F,Xi,T |
| Risk Statements | 11-36/37/38-66-48/20-60 |
| Safety Statements | 16-23-26-36-45-53 |
| RIDADR | UN 2344 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Repr. 1A STOT RE 2 Inhalation |
