PRODUCT Properties
| Melting point: | 223-227 °C(lit.) |
| Boiling point: | 359.0±25.0 °C(Predicted) |
| Density | 1.333±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 2.90±0.10(Predicted) |
| color | White to Yellow to Orange |
| λmax | 267nm(H2SO4 aq.)(lit.) |
| InChI | InChI=1S/C8H7N3S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) |
| InChIKey | UHZHEOAEJRHUBW-UHFFFAOYSA-N |
| SMILES | S1C(C2=CC=CC=C2)=NN=C1N |
Description and Uses
2-Amino-5-phenyl-1,3,4-thiadiazole may be used for the synthesis of 1,3,4-thiadiazole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
