A0268056
AzoxystrobinSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty 2%
CAS NO.:
Empirical Formula: C22H17N3O5
Molecular Weight: 403.39
MDL number: MFCD08277047
EINECS: 204-037-5
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-119° |
| Boiling point: | 581.3±50.0 °C(Predicted) |
| Density | 1.33 |
| vapor pressure | 1.1 x 10-10 Pa (25 °C) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform: Slightly Soluble |
| Colour Index | 23860 |
| form | Solid |
| pka | -0.93±0.18(Predicted) |
| Water Solubility | 6 mg l-1 (20 °C) |
| color | White to yellow |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C22H17N3O5/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23/h3-11,13-14H,1-2H3/b17-13+ |
| InChIKey | WFDXOXNFNRHQEC-GHRIWEEISA-N |
| SMILES | C1(=CC=CC=C1OC1N=CN=C(OC2=CC=CC=C2C#N)C=1)/C(=C\OC)/C(=O)OC |
| LogP | 2.500 |
| CAS DataBase Reference | 131860-33-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Azoxystrobin(131860-33-8) |
| EPA Substance Registry System | Azoxystrobin (131860-33-8) |
Description and Uses
Azoxystrobin is a second broad-spectrum strobilurin fungicide (28,29). It forms white solids with a mp = 116 ?C; vp = 1.1 × 10?7 mPa at 25 ?C; logP = 2.5 at 20?C; water solubility = 6 mg/L; and a half-life of 11 to 17 days for aqueous photolysis.
Strobilurin fungicide; inhibits mitochondrial respiration by blocking electron transfer between cytochromes b and c1. Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H331-H410 |
| Precautionary statements | P261-P271-P273-P304+P340+P311-P391-P403+P233 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T;N,N,T |
| Risk Statements | 23-50/53 |
| Safety Statements | 22-45-60-61 |
| RIDADR | UN 2811 |
| WGK Germany | 2 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 131860-33-8(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally (Godwin) |





