A0278056
                    bADA , >98%
                            Synonym(s):
Bromoacetaldehyde dimethyl acetal
                            
                        
                CAS NO.:
Empirical Formula: C4H9BrO2
Molecular Weight: 169.02
MDL number: MFCD00000213
EINECS: 230-669-6
| Pack Size | Price | Stock | Quantity | 
| 2mg | RMB4002.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 148-150 °C (lit.) | 
                                    
| Density | 1.43 g/mL at 25 °C (lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | 129 °F | 
                                    
| storage temp. | 2-8°C | 
                                    
| form | clear liquid | 
                                    
| color | Colorless to Light orange to Yellow | 
                                    
| Specific Gravity | 1.445 | 
                                    
| Water Solubility | insoluble | 
                                    
| Sensitive | Moisture Sensitive | 
                                    
| BRN | 1280132 | 
                                    
| InChI | InChI=1S/C4H9BrO2/c1-6-4(3-5)7-2/h4H,3H2,1-2H3 | 
                                    
| InChIKey | FUSFWUFSEJXMRQ-UHFFFAOYSA-N | 
                                    
| SMILES | C(OC)(OC)CBr | 
                                    
| CAS DataBase Reference | 7252-83-7(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Ethane, 2-bromo-1,1-dimethoxy-(7252-83-7) | 
                                    
| EPA Substance Registry System | Ethane, 2-bromo-1,1-dimethoxy- (7252-83-7) | 
                                    
Description and Uses
2-Bromo-1,1-dimethoxyethane (Bromoacetaldehyde dimethyl acetal) was used in the synthesis of 2,3-O-acetal via reaction with 2,3-diol in the presence of 10-camphorsulphonic acid (CSA).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H226-H315-H319 | 
| Precautionary statements | P210-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 10-36-36/37/38 | 
| Safety Statements | 26-36/39-28A-16 | 
| RIDADR | UN 1989 3/PG 3 | 
| WGK Germany | 3 | 
| F | 8-9-21 | 
| TSCA | Yes | 
| HazardClass | 3 | 
| PackingGroup | III | 
| HS Code | 29110000 | 
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | 
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | 





