A0278056
bADA , >98%
Synonym(s):
Bromoacetaldehyde dimethyl acetal
CAS NO.:
Empirical Formula: C4H9BrO2
Molecular Weight: 169.02
MDL number: MFCD00000213
EINECS: 230-669-6
| Pack Size | Price | Stock | Quantity |
| 2mg | RMB4002.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 148-150 °C (lit.) |
| Density | 1.43 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 129 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.445 |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 1280132 |
| InChI | InChI=1S/C4H9BrO2/c1-6-4(3-5)7-2/h4H,3H2,1-2H3 |
| InChIKey | FUSFWUFSEJXMRQ-UHFFFAOYSA-N |
| SMILES | C(OC)(OC)CBr |
| CAS DataBase Reference | 7252-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethane, 2-bromo-1,1-dimethoxy-(7252-83-7) |
| EPA Substance Registry System | Ethane, 2-bromo-1,1-dimethoxy- (7252-83-7) |
Description and Uses
2-Bromo-1,1-dimethoxyethane (Bromoacetaldehyde dimethyl acetal) was used in the synthesis of 2,3-O-acetal via reaction with 2,3-diol in the presence of 10-camphorsulphonic acid (CSA).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36-36/37/38 |
| Safety Statements | 26-36/39-28A-16 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| F | 8-9-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29110000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





