A0310656
Triphenyl-2,6-xylylbismuthoniumTetrafluoroborate , >98.0%(T)(HPLC)
Synonym(s):
o-Chloranil
CAS NO.:
Empirical Formula: C6Cl4O2
Molecular Weight: 245.88
MDL number: MFCD00001646
EINECS: 219-424-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB276.00 | In Stock |
|
| 1g | RMB1100.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C(lit.) |
| Boiling point: | 164.7±40.0 °C(Predicted) |
| Density | 1.7462 (estimate) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | Fine Crystalline Powder |
| color | Bordeaux |
| Water Solubility | insoluble |
| BRN | 1309782 |
| InChI | 1S/C6Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | VRGCYEIGVVTZCC-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(=O)C(=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 2435-53-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Cyclohexadiene-1,2-dione, 3,4,5,6-tetrachloro-(2435-53-2) |
| EPA Substance Registry System | o-Chloranil (2435-53-2) |
Description and Uses
o-Chloranil is used as a reagent in the synthesis of fused triazolotriazines and triazolotriazepines which exhibit antibacterial activity. Also used as a reagent in the synthesis of nickel diimine catecholate charge-transfer complexes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H410 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50/53-36/38-20 |
| Safety Statements | 26-36-61-60-37-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |






