A0421556
Bis(triphenylphosphine)palladiumdichloride , 99.95%metalsbasis , 13965-03-2
Synonym(s):
Dichlorobis(triphenylphosphine)palladium(II);Palladium(II)bis(triphenylphosphine) dichloride;PdCl2(PPh3)2;PdCl2(PPh3)2 impregnated tablets;Bis(triphenylphosphine)palladium(II) chloride (15.2% Pd)
CAS NO.:13965-03-2
Empirical Formula: C36H30Cl2P2Pd
Molecular Weight: 701.9
MDL number: MFCD00009593
EINECS: 237-744-2
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB463.20 | In Stock |
|
| 1g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260°C |
| vapor pressure | 0Pa at 25℃ |
| RTECS | RT3578000 |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly, Heated), Methanol (Slightly, |
| form | Powder |
| color | Yellow |
| Water Solubility | Insoluble in water. Soluble in benzene, and toluene. |
| Sensitive | Hygroscopic |
| BRN | 4935975 |
| InChI | InChI=1S/2C18H15P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ILBDOZRDKNIJBS-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C1=CC=CC=C1)C1C=CC=CC=1.P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Pd](Cl)Cl |
| LogP | 5.69 at 20℃ |
| CAS DataBase Reference | 13965-03-2(CAS DataBase Reference) |
Description and Uses
Bis(triphenylphosphine)palladium(II) chloride is used primarily in organometallic catalytic reactions due to the palladium content of the compound. It is also involved in crystalized structures of me tallacyclic complexes which show antiinflammatory and antifungal properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H413 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22-40-19 |
| Safety Statements | 37/39-26-36/37 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | No |
| HS Code | 28439090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Skin Sens. 1A |





