A0447456
2,3-Dimethyl-1-propylimidazoliumBis(trifluoromethanesulfonyl)imide , 99% , 169051-76-7
CAS NO.:169051-76-7
Empirical Formula: C8H15N2.C2F6NO4S2
Molecular Weight: 419.366
MDL number: MFCD03788922
EINECS: 200-145-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB791.20 | In Stock |
|
| 5g | RMB3151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15 °C (lit.) |
| Density | 1.436 g/mL at 25 °C |
| vapor pressure | 1.6-18.665hPa at 20-260℃ |
| refractive index | n20/D 1.433 |
| Flash point: | >110°C |
| storage temp. | Store at room temperature, keep dry and cool |
| form | liquid |
| Specific Gravity | 1.47 |
| color | colorless to pale yellow |
| InChI | 1S/C8H15N2.C2F6NO4S2/c1-4-5-10-7-6-9(3)8(10)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-7H,4-5H2,1-3H3;/q+1;-1 |
| InChIKey | XOZHIVUWCICHSQ-UHFFFAOYSA-N |
| SMILES | CCC[n+]1ccn(C)c1C.FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| LogP | 2.369 at 25℃ and pH6-7 |
| CAS DataBase Reference | 169051-76-7 |
Description and Uses
Dye sensitized solar cell, capacitor technology, polymer gel electrolytes, proton membranes, batteries1,2,3,4
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29350090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







