A1189312
1-Butyl-2,3-dimethylimidazolium tetrafluoroborate , 97% , 402846-78-0
Synonym(s):
[BDMIM][BF4]
CAS NO.:402846-78-0
Empirical Formula: C9H17BF4N2
Molecular Weight: 240.05
MDL number: MFCD03427618
EINECS: 200-145-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100G | RMB692.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C |
| Density | 1.198 g/mL at 20 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | liquid |
| color | pale yellow |
| InChI | 1S/C9H17N2.BF4/c1-4-5-6-11-8-7-10(3)9(11)2;2-1(3,4)5/h7-8H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | VCAIYEJBOWHUGP-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CCCCn1cc[n+](C)c1C |
| CAS DataBase Reference | 402846-78-0(CAS DataBase Reference) |
Description and Uses
1-Butyl-2,3-dimethylimidazolium tetrafluoroborate can be used as a component of graphene nanoribbon and cobalt phthalocyanine based nanocomposites modified electrode, which is applicable in the determination of pesticide fenobucarb in vegetables.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |







