A0494156
CyanazineSolutioninAcetonitrile , 1000 μg/mlinaCetonitrile, uncertainty: 2% , 21725-46-2
CAS NO.:21725-46-2
Empirical Formula: C9H13ClN6
Molecular Weight: 240.69
MDL number: MFCD00055514
EINECS: 244-544-9
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167°C |
| Boiling point: | 383.12°C (rough estimate) |
| Density | 1.2870 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 100 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO: 100 mg/mL (415.47 mM) |
| form | Granular Powder |
| pka | 1.46±0.41(Predicted) |
| color | Off-white |
| Water Solubility | 0.0171 g/100 mL |
| Merck | 13,2714 |
| BRN | 615509 |
| Major Application | agriculture environmental |
| InChI | 1S/C9H13ClN6/c1-4-12-7-13-6(10)14-8(15-7)16-9(2,3)5-11/h4H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | MZZBPDKVEFVLFF-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NC(C)(C)C#N)n1 |
| CAS DataBase Reference | 21725-46-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyanazine(21725-46-2) |
| EPA Substance Registry System | Cyanazine (21725-46-2) |
Description and Uses
Cyanazine is an off-white to tan crystallinesolid. Molecular weight=240.73; Freezing/Meltingpoint=167-169℃. Hazard Identification (based on NFPA-704 M Rating System): Health 2, Flammability 1,Reactivity 0. Soluble in water. Physical properties may bealtered by carrier solvents used in commercial formulations
Selective pre-emergence herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn;N,N,Xn,T,F |
| Risk Statements | 22-50/53-39/23/24/25-23/24/25-36-20/21/22-11-52/53 |
| Safety Statements | 37-60-61-45-36/37-36-26-16 |
| RIDADR | UN 2588/2811 |
| WGK Germany | 3 |
| RTECS | UG1490000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 21725-46-2(Hazardous Substances Data) |
| Toxicity | LD50 in rats, mice (mg/kg): 182, 380 orally (Chapman) |






