A0501956
Trimethylsilyltrifluoromethanesulfonate , ≥99% , 27607-77-8
Synonym(s):
TMSOTf;Trimethylsilyl trifluoromethanesulfonate;TMS triflate;Trifluoromethanesulfonic acid trimethylsilylester;Trimethylsilyl triflate, Trifluoromethanesulfonic acid trimethylsilyl ester
CAS NO.:27607-77-8
Empirical Formula: C4H9F3O3SSi
Molecular Weight: 222.26
MDL number: MFCD00000406
EINECS: 248-565-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25g | RMB55.20 | In Stock |
|
| 100g | RMB119.20 | In Stock |
|
| 500g | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 77 °C/80 mmHg (lit.) |
| Density | 1.228 g/mL at 25 °C (lit.) |
| vapor pressure | 4.7 hPa (20 °C) |
| refractive index | n |
| Flash point: | 78 °F |
| storage temp. | Store below +30°C. |
| solubility | sol aliphatic and aromatic hydrocarbons, haloalkanes,
ethers. |
| form | Fuming Liquid |
| color | Clear colorless to light brown |
| Specific Gravity | 1.15 |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Merck | 14,9719 |
| BRN | 1868911 |
| InChI | 1S/C4H9F3O3SSi/c1-12(2,3)10-11(8,9)4(5,6)7/h1-3H3 |
| InChIKey | FTVLMFQEYACZNP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 27607-77-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Trimethylsilyl trifluoromethanesulfonate(27607-77-8) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, trimethylsilyl ester (27607-77-8) |
Description and Uses
Trimethylsilyl Trifluoromethanesulfonate is a trialkylsilyl triflate used as a catalyst in organic synthesis. Trimethylsilyl Trifluoromethanesulfonate is used in combination with boron trifluoride eth yl ether to prepare a Lewis acid that is more powerful than its components and especially effective in acetonitrile solvent. Trimethylsilyl is a common reagent used in a Dieckmann-like cyclization of ester-imides and diesters.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F |
| Risk Statements | 10-14-34 |
| Safety Statements | 16-26-36/37/39-45-8 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Autoignition Temperature | 405 °C DIN 51794 |
| Hazard Note | Corrosive/Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







