A0520656
2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine , 99% , 23449-08-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5g | RMB119.20 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| 100g | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200.0 to 204.0 °C |
| Boiling point: | 573.9±52.0 °C(Predicted) |
| Density | 1.381 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.45±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C21H14BrN3/c22-18-13-11-17(12-14-18)21-24-19(15-7-3-1-4-8-15)23-20(25-21)16-9-5-2-6-10-16/h1-14H |
| InChIKey | AYHGAQGOMUQMTR-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C1C1=CC=C(Br)C=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 29336990 |





