A1573612
2-(3-Bromophenyl)-4,6-diphenyl-1,3,5-triazine , >97.0%(HPLC)(N) , 864377-31-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB167.20 | In Stock |
|
| 25G | RMB429.60 | In Stock |
|
| 100G | RMB1600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174.0 to 178.0 °C |
| Boiling point: | 583.6±52.0 °C(Predicted) |
| Density | 1.381 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 0.65±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C21H14BrN3/c22-18-13-7-12-17(14-18)21-24-19(15-8-3-1-4-9-15)23-20(25-21)16-10-5-2-6-11-16/h1-14H |
| InChIKey | HNZUKQQNZRMNGS-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C1C1=CC=CC(Br)=C1 |
Description and Uses
As an organic intermediate, 2-(3-Bromophenyl)-4,6-diphenyl-1,3,5-triazine can be used to synthesize nitrogen-containing organic compounds. In pharmaceutical chemistry, it can be used to synthesize biologically active compounds such as bactericides, antiviral drugs, etc. In materials science, it can be used as a synthetic intermediate for liquid crystal materials and optoelectronic materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 29339900 |





